C23H34N4O2 — CID 133112087
6-[(4aS,6S,8aR)-8a-(methoxymethyl)-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinolin-2-yl]-2,4-dimethylpyridine-3-carbonitrile (PubChem CID 133112087) has the molecular formula C23H34N4O2 and a molecular weight of 398.55 g/mol. Its IUPAC name is 6-[(4aS,6S,8aR)-8a-(methoxymethyl)-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinolin-2-yl]-2,4-dimethylpyridine-3-carbonitrile.
| Compound Name | 6-[(4aS,6S,8aR)-8a-(methoxymethyl)-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinolin-2-yl]-2,4-dimethylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 133112087 |
| Molecular Formula | C23H34N4O2 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | 6-[(4aS,6S,8aR)-8a-(methoxymethyl)-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinolin-2-yl]-2,4-dimethylpyridine-3-carbonitrile |
| SMILES | COC[C@]12CC[C@H](N3CCOCC3)C[C@@H]1CCN(c1cc(C)c(C#N)c(C)n1)C2 |
| InChI | InChI=1S/C23H34N4O2/c1-17-12-22(25-18(2)21(17)14-24)27-7-5-19-13-20(26-8-10-29-11-9-26)4-6-23(19,15-27)16-28-3/h12,19-20H,4-11,13,15-16H2,1-3H3/t19-,20-,23+/m0/s1 |
| InChIKey | YLSJKIYVOFKLBE-SXWKCWPCSA-N |
| XLogP | 2.91 |
| TPSA | 61.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |