C20H33N5O2 — CID 72913725
2-[(4aR,6R,8aS)-8a-(methoxymethyl)-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinolin-2-yl]-N-methylpyrimidin-4-amine (PubChem CID 72913725) has the molecular formula C20H33N5O2 and a molecular weight of 375.52 g/mol. Its IUPAC name is 2-[(4aR,6R,8aS)-8a-(methoxymethyl)-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinolin-2-yl]-N-methylpyrimidin-4-amine.
| Compound Name | 2-[(4aR,6R,8aS)-8a-(methoxymethyl)-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinolin-2-yl]-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 72913725 |
| Molecular Formula | C20H33N5O2 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.26 |
| IUPAC Name | 2-[(4aR,6R,8aS)-8a-(methoxymethyl)-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinolin-2-yl]-N-methylpyrimidin-4-amine |
| SMILES | CNc1ccnc(N2CC[C@@H]3C[C@H](N4CCOCC4)CC[C@@]3(COC)C2)n1 |
| InChI | InChI=1S/C20H33N5O2/c1-21-18-4-7-22-19(23-18)25-8-5-16-13-17(24-9-11-27-12-10-24)3-6-20(16,14-25)15-26-2/h4,7,16-17H,3,5-6,8-15H2,1-2H3,(H,21,22,23)/t16-,17-,20+/m1/s1 |
| InChIKey | IXQUTIGRDFLQNA-HLIPFELVSA-N |
| XLogP | 1.86 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |