C22H37N5O2 — CID 133138602
2-[(4aS,6S,8aR)-8a-(methoxymethyl)-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinolin-2-yl]-N,N,5-trimethylpyrimidin-4-amine (PubChem CID 133138602) has the molecular formula C22H37N5O2 and a molecular weight of 403.57 g/mol. Its IUPAC name is 2-[(4aS,6S,8aR)-8a-(methoxymethyl)-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinolin-2-yl]-N,N,5-trimethylpyrimidin-4-amine.
| Compound Name | 2-[(4aS,6S,8aR)-8a-(methoxymethyl)-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinolin-2-yl]-N,N,5-trimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 133138602 |
| Molecular Formula | C22H37N5O2 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.29 |
| IUPAC Name | 2-[(4aS,6S,8aR)-8a-(methoxymethyl)-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinolin-2-yl]-N,N,5-trimethylpyrimidin-4-amine |
| SMILES | COC[C@]12CC[C@H](N3CCOCC3)C[C@@H]1CCN(c1ncc(C)c(N(C)C)n1)C2 |
| InChI | InChI=1S/C22H37N5O2/c1-17-14-23-21(24-20(17)25(2)3)27-8-6-18-13-19(26-9-11-29-12-10-26)5-7-22(18,15-27)16-28-4/h14,18-19H,5-13,15-16H2,1-4H3/t18-,19-,22+/m0/s1 |
| InChIKey | VTUCLNHNLPUFTI-CNNODRBYSA-N |
| XLogP | 2.19 |
| TPSA | 53.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |