C21H32N4O3 — CID 72916193
2-[(4aR,6R,8aS)-8a-(methoxymethyl)-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinolin-2-yl]pyridine-3-carboxamide (PubChem CID 72916193) has the molecular formula C21H32N4O3 and a molecular weight of 388.51 g/mol. Its IUPAC name is 2-[(4aR,6R,8aS)-8a-(methoxymethyl)-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinolin-2-yl]pyridine-3-carboxamide.
| Compound Name | 2-[(4aR,6R,8aS)-8a-(methoxymethyl)-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinolin-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 72916193 |
| Molecular Formula | C21H32N4O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | 2-[(4aR,6R,8aS)-8a-(methoxymethyl)-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinolin-2-yl]pyridine-3-carboxamide |
| SMILES | COC[C@@]12CC[C@@H](N3CCOCC3)C[C@H]1CCN(c1ncccc1C(N)=O)C2 |
| InChI | InChI=1S/C21H32N4O3/c1-27-15-21-6-4-17(24-9-11-28-12-10-24)13-16(21)5-8-25(14-21)20-18(19(22)26)3-2-7-23-20/h2-3,7,16-17H,4-6,8-15H2,1H3,(H2,22,26)/t16-,17-,21+/m1/s1 |
| InChIKey | FCUMVZKIXYEHFR-LZJOCLMNSA-N |
| XLogP | 1.52 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |