C22H33N3O3 — CID 72886029
ethyl (4aR,6R,8aS)-2-(2-methyl-4-pyridinyl)-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinoline-8a-carboxylate (PubChem CID 72886029) has the molecular formula C22H33N3O3 and a molecular weight of 387.52 g/mol. Its IUPAC name is ethyl (4aR,6R,8aS)-2-(2-methyl-4-pyridinyl)-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinoline-8a-carboxylate.
| Compound Name | ethyl (4aR,6R,8aS)-2-(2-methyl-4-pyridinyl)-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinoline-8a-carboxylate |
|---|---|
| PubChem CID | 72886029 |
| Molecular Formula | C22H33N3O3 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | ethyl (4aR,6R,8aS)-2-(2-methyl-4-pyridinyl)-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinoline-8a-carboxylate |
| SMILES | CCOC(=O)[C@@]12CC[C@@H](N3CCOCC3)C[C@H]1CCN(c1ccnc(C)c1)C2 |
| InChI | InChI=1S/C22H33N3O3/c1-3-28-21(26)22-7-4-19(24-10-12-27-13-11-24)15-18(22)6-9-25(16-22)20-5-8-23-17(2)14-20/h5,8,14,18-19H,3-4,6-7,9-13,15-16H2,1-2H3/t18-,19-,22-/m1/s1 |
| InChIKey | HCEUSWDCOGOSHR-WOIUINJBSA-N |
| XLogP | 2.65 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |