C24H38N4O6 — CID 154923026
ethyl (4aR,6S,8aS)-2-[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinoline-8a-carboxylate;formic acid (PubChem CID 154923026) has the molecular formula C24H38N4O6 and a molecular weight of 478.59 g/mol. Its IUPAC name is ethyl (4aR,6S,8aS)-2-[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinoline-8a-carboxylate;formic acid.
| Compound Name | ethyl (4aR,6S,8aS)-2-[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinoline-8a-carboxylate;formic acid |
|---|---|
| PubChem CID | 154923026 |
| Molecular Formula | C24H38N4O6 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.28 |
| IUPAC Name | ethyl (4aR,6S,8aS)-2-[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinoline-8a-carboxylate;formic acid |
| SMILES | CCOC(=O)[C@@]12CC[C@H](N3CCOCC3)C[C@H]1CCN(C(=O)Cc1c(C)n[nH]c1C)C2.O=CO |
| InChI | InChI=1S/C23H36N4O4.CH2O2/c1-4-31-22(29)23-7-5-19(26-9-11-30-12-10-26)13-18(23)6-8-27(15-23)21(28)14-20-16(2)24-25-17(20)3;2-1-3/h18-19H,4-15H2,1-3H3,(H,24,25);1H,(H,2,3)/t18-,19+,23-;/m1./s1 |
| InChIKey | PUICMVUAACKOQF-KQCMKQOESA-N |
| XLogP | 1.55 |
| TPSA | 125.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|