C25H44N6O6 — CID 154921632
(4aR,6S,8aS)-N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-2-ethyl-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinoline-8a-carboxamide;formic acid (PubChem CID 154921632) has the molecular formula C25H44N6O6 and a molecular weight of 524.66 g/mol. Its IUPAC name is (4aR,6S,8aS)-N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-2-ethyl-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinoline-8a-carboxamide;formic acid.
| Compound Name | (4aR,6S,8aS)-N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-2-ethyl-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinoline-8a-carboxamide;formic acid |
|---|---|
| PubChem CID | 154921632 |
| Molecular Formula | C25H44N6O6 |
| Molecular Weight | 524.66 g/mol |
| Exact Mass | 524.33 |
| IUPAC Name | (4aR,6S,8aS)-N-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-2-ethyl-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinoline-8a-carboxamide;formic acid |
| SMILES | CCN1CC[C@@H]2C[C@@H](N3CCOCC3)CC[C@@]2(C(=O)NCCCn2nc(C)nc2C)C1.O=CO.O=CO |
| InChI | InChI=1S/C23H40N6O2.2CH2O2/c1-4-27-11-7-20-16-21(28-12-14-31-15-13-28)6-8-23(20,17-27)22(30)24-9-5-10-29-19(3)25-18(2)26-29;2*2-1-3/h20-21H,4-17H2,1-3H3,(H,24,30);2*1H,(H,2,3)/t20-,21+,23-;;/m1../s1 |
| InChIKey | CJMZXZPTIIQQBI-QMIOCMNCSA-N |
| XLogP | 1.02 |
| TPSA | 150.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.66 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|