C22H35N5O2 — CID 162630092
(4aR,6R,8aS)-2-(2-methylpyrimidin-4-yl)-6-morpholin-4-yl-N-propyl-1,3,4,4a,5,6,7,8-octahydroisoquinoline-8a-carboxamide (PubChem CID 162630092) has the molecular formula C22H35N5O2 and a molecular weight of 401.56 g/mol. Its IUPAC name is (4aR,6R,8aS)-2-(2-methylpyrimidin-4-yl)-6-morpholin-4-yl-N-propyl-1,3,4,4a,5,6,7,8-octahydroisoquinoline-8a-carboxamide.
| Compound Name | (4aR,6R,8aS)-2-(2-methylpyrimidin-4-yl)-6-morpholin-4-yl-N-propyl-1,3,4,4a,5,6,7,8-octahydroisoquinoline-8a-carboxamide |
|---|---|
| PubChem CID | 162630092 |
| Molecular Formula | C22H35N5O2 |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.28 |
| IUPAC Name | (4aR,6R,8aS)-2-(2-methylpyrimidin-4-yl)-6-morpholin-4-yl-N-propyl-1,3,4,4a,5,6,7,8-octahydroisoquinoline-8a-carboxamide |
| SMILES | CCCNC(=O)[C@@]12CC[C@@H](N3CCOCC3)C[C@H]1CCN(c1ccnc(C)n1)C2 |
| InChI | InChI=1S/C22H35N5O2/c1-3-8-24-21(28)22-7-4-19(26-11-13-29-14-12-26)15-18(22)6-10-27(16-22)20-5-9-23-17(2)25-20/h5,9,18-19H,3-4,6-8,10-16H2,1-2H3,(H,24,28)/t18-,19-,22-/m1/s1 |
| InChIKey | WKOCJIHGOHEHDI-WOIUINJBSA-N |
| XLogP | 2.01 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |