C23H37N5O3 — CID 157013444
(4aR,6S,8aS)-2-(4-ethyl-5-methylpyrimidin-2-yl)-N-(2-hydroxyethyl)-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinoline-8a-carboxamide (PubChem CID 157013444) has the molecular formula C23H37N5O3 and a molecular weight of 431.58 g/mol. Its IUPAC name is (4aR,6S,8aS)-2-(4-ethyl-5-methylpyrimidin-2-yl)-N-(2-hydroxyethyl)-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinoline-8a-carboxamide.
| Compound Name | (4aR,6S,8aS)-2-(4-ethyl-5-methylpyrimidin-2-yl)-N-(2-hydroxyethyl)-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinoline-8a-carboxamide |
|---|---|
| PubChem CID | 157013444 |
| Molecular Formula | C23H37N5O3 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.29 |
| IUPAC Name | (4aR,6S,8aS)-2-(4-ethyl-5-methylpyrimidin-2-yl)-N-(2-hydroxyethyl)-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinoline-8a-carboxamide |
| SMILES | CCc1nc(N2CC[C@@H]3C[C@@H](N4CCOCC4)CC[C@@]3(C(=O)NCCO)C2)ncc1C |
| InChI | InChI=1S/C23H37N5O3/c1-3-20-17(2)15-25-22(26-20)28-8-5-18-14-19(27-9-12-31-13-10-27)4-6-23(18,16-28)21(30)24-7-11-29/h15,18-19,29H,3-14,16H2,1-2H3,(H,24,30)/t18-,19+,23-/m1/s1 |
| InChIKey | ONDXQHOAONOURI-SELNLUPBSA-N |
| XLogP | 1.15 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |