C24H33N5O2 — CID 162638912
(4aR,6S,8aS)-2-(6-cyano-2-pyridinyl)-N-cyclobutyl-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinoline-8a-carboxamide (PubChem CID 162638912) has the molecular formula C24H33N5O2 and a molecular weight of 423.56 g/mol. Its IUPAC name is (4aR,6S,8aS)-2-(6-cyano-2-pyridinyl)-N-cyclobutyl-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinoline-8a-carboxamide.
| Compound Name | (4aR,6S,8aS)-2-(6-cyano-2-pyridinyl)-N-cyclobutyl-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinoline-8a-carboxamide |
|---|---|
| PubChem CID | 162638912 |
| Molecular Formula | C24H33N5O2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | (4aR,6S,8aS)-2-(6-cyano-2-pyridinyl)-N-cyclobutyl-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinoline-8a-carboxamide |
| SMILES | N#Cc1cccc(N2CC[C@@H]3C[C@@H](N4CCOCC4)CC[C@@]3(C(=O)NC3CCC3)C2)n1 |
| InChI | InChI=1S/C24H33N5O2/c25-16-20-5-2-6-22(26-20)29-10-8-18-15-21(28-11-13-31-14-12-28)7-9-24(18,17-29)23(30)27-19-3-1-4-19/h2,5-6,18-19,21H,1,3-4,7-15,17H2,(H,27,30)/t18-,21+,24-/m1/s1 |
| InChIKey | BFUUVZZOANWETJ-UTSGNWPNSA-N |
| XLogP | 2.32 |
| TPSA | 81.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |