C21H32N2O3S — CID 70772452
[(4aR,6R,8aS)-8a-(methoxymethyl)-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinolin-2-yl]-(5-methylthiophen-3-yl)methanone (PubChem CID 70772452) has the molecular formula C21H32N2O3S and a molecular weight of 392.57 g/mol. Its IUPAC name is [(4aR,6R,8aS)-8a-(methoxymethyl)-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinolin-2-yl]-(5-methylthiophen-3-yl)methanone.
| Compound Name | [(4aR,6R,8aS)-8a-(methoxymethyl)-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinolin-2-yl]-(5-methylthiophen-3-yl)methanone |
|---|---|
| PubChem CID | 70772452 |
| Molecular Formula | C21H32N2O3S |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | [(4aR,6R,8aS)-8a-(methoxymethyl)-6-morpholin-4-yl-1,3,4,4a,5,6,7,8-octahydroisoquinolin-2-yl]-(5-methylthiophen-3-yl)methanone |
| SMILES | COC[C@@]12CC[C@@H](N3CCOCC3)C[C@H]1CCN(C(=O)c1csc(C)c1)C2 |
| InChI | InChI=1S/C21H32N2O3S/c1-16-11-17(13-27-16)20(24)23-6-4-18-12-19(22-7-9-26-10-8-22)3-5-21(18,14-23)15-25-2/h11,13,18-19H,3-10,12,14-15H2,1-2H3/t18-,19-,21+/m1/s1 |
| InChIKey | QVHOIAJDDGDJPE-SBHAEUEKSA-N |
| XLogP | 3.04 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |