C20H32N2O2S — CID 56899919
4-[(4aR,6R,8aS)-8a-(methoxymethyl)-2-(thiophen-3-ylmethyl)-1,3,4,4a,5,6,7,8-octahydroisoquinolin-6-yl]morpholine (PubChem CID 56899919) has the molecular formula C20H32N2O2S and a molecular weight of 364.56 g/mol. Its IUPAC name is 4-[(4aR,6R,8aS)-8a-(methoxymethyl)-2-(thiophen-3-ylmethyl)-1,3,4,4a,5,6,7,8-octahydroisoquinolin-6-yl]morpholine.
| Compound Name | 4-[(4aR,6R,8aS)-8a-(methoxymethyl)-2-(thiophen-3-ylmethyl)-1,3,4,4a,5,6,7,8-octahydroisoquinolin-6-yl]morpholine |
|---|---|
| PubChem CID | 56899919 |
| Molecular Formula | C20H32N2O2S |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 4-[(4aR,6R,8aS)-8a-(methoxymethyl)-2-(thiophen-3-ylmethyl)-1,3,4,4a,5,6,7,8-octahydroisoquinolin-6-yl]morpholine |
| SMILES | COC[C@@]12CC[C@@H](N3CCOCC3)C[C@H]1CCN(Cc1ccsc1)C2 |
| InChI | InChI=1S/C20H32N2O2S/c1-23-16-20-5-2-19(22-7-9-24-10-8-22)12-18(20)3-6-21(15-20)13-17-4-11-25-14-17/h4,11,14,18-19H,2-3,5-10,12-13,15-16H2,1H3/t18-,19-,20+/m1/s1 |
| InChIKey | CAKBDPZACGWORH-AQNXPRMDSA-N |
| XLogP | 3.09 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |