C17H27N5O7 — CID 154923086
(3aR,6aR)-5-[2-(ethylamino)-2-oxoethyl]-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxamide;formic acid (PubChem CID 154923086) has the molecular formula C17H27N5O7 and a molecular weight of 413.43 g/mol. Its IUPAC name is (3aR,6aR)-5-[2-(ethylamino)-2-oxoethyl]-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxamide;formic acid.
| Compound Name | (3aR,6aR)-5-[2-(ethylamino)-2-oxoethyl]-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxamide;formic acid |
|---|---|
| PubChem CID | 154923086 |
| Molecular Formula | C17H27N5O7 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | (3aR,6aR)-5-[2-(ethylamino)-2-oxoethyl]-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxamide;formic acid |
| SMILES | CCNC(=O)CN1C[C@@H]2COC[C@]2(C(=O)NCCOc2nonc2C)C1.O=CO |
| InChI | InChI=1S/C16H25N5O5.CH2O2/c1-3-17-13(22)7-21-6-12-8-24-10-16(12,9-21)15(23)18-4-5-25-14-11(2)19-26-20-14;2-1-3/h12H,3-10H2,1-2H3,(H,17,22)(H,18,23);1H,(H,2,3)/t12-,16-;/m1./s1 |
| InChIKey | XTYDOBZNXPXBIZ-VQZRABBESA-N |
| XLogP | -1.34 |
| TPSA | 156.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|