C23H16F3N — CID 154926426
2,5-diphenyl-1-[4-(trifluoromethyl)phenyl]pyrrole (PubChem CID 154926426) has the molecular formula C23H16F3N and a molecular weight of 363.38 g/mol. Its IUPAC name is 2,5-diphenyl-1-[4-(trifluoromethyl)phenyl]pyrrole.
| Compound Name | 2,5-diphenyl-1-[4-(trifluoromethyl)phenyl]pyrrole |
|---|---|
| PubChem CID | 154926426 |
| Molecular Formula | C23H16F3N |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 2,5-diphenyl-1-[4-(trifluoromethyl)phenyl]pyrrole |
| SMILES | FC(F)(F)c1ccc(-n2c(-c3ccccc3)ccc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H16F3N/c24-23(25,26)19-11-13-20(14-12-19)27-21(17-7-3-1-4-8-17)15-16-22(27)18-9-5-2-6-10-18/h1-16H |
| InChIKey | UHVOYKJJEUWYQT-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |