C26H26Cl2O3 — CID 154928179
[2-(2,3-dimethyl-6-propoxyphenyl)-3,4-dimethylphenyl] 2,4-dichlorobenzoate (PubChem CID 154928179) has the molecular formula C26H26Cl2O3 and a molecular weight of 457.40 g/mol. Its IUPAC name is [2-(2,3-dimethyl-6-propoxyphenyl)-3,4-dimethylphenyl] 2,4-dichlorobenzoate.
| Compound Name | [2-(2,3-dimethyl-6-propoxyphenyl)-3,4-dimethylphenyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 154928179 |
| Molecular Formula | C26H26Cl2O3 |
| Molecular Weight | 457.40 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | [2-(2,3-dimethyl-6-propoxyphenyl)-3,4-dimethylphenyl] 2,4-dichlorobenzoate |
| SMILES | CCCOc1ccc(C)c(C)c1-c1c(OC(=O)c2ccc(Cl)cc2Cl)ccc(C)c1C |
| InChI | InChI=1S/C26H26Cl2O3/c1-6-13-30-22-11-7-15(2)17(4)24(22)25-18(5)16(3)8-12-23(25)31-26(29)20-10-9-19(27)14-21(20)28/h7-12,14H,6,13H2,1-5H3 |
| InChIKey | ZLNOGKWLXRPJSS-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.40 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|