C24H24ClFN8O — CID 154929229
8-chloro-N-cyclopropyl-1-[6-(5-fluoro-2-pyridinyl)-2,6-diazaspiro[3.3]heptan-2-yl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine-5-carboxamide (PubChem CID 154929229) has the molecular formula C24H24ClFN8O and a molecular weight of 494.96 g/mol. Its IUPAC name is 8-chloro-N-cyclopropyl-1-[6-(5-fluoro-2-pyridinyl)-2,6-diazaspiro[3.3]heptan-2-yl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine-5-carboxamide.
| Compound Name | 8-chloro-N-cyclopropyl-1-[6-(5-fluoro-2-pyridinyl)-2,6-diazaspiro[3.3]heptan-2-yl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine-5-carboxamide |
|---|---|
| PubChem CID | 154929229 |
| Molecular Formula | C24H24ClFN8O |
| Molecular Weight | 494.96 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | 8-chloro-N-cyclopropyl-1-[6-(5-fluoro-2-pyridinyl)-2,6-diazaspiro[3.3]heptan-2-yl]-4,6-dihydro-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine-5-carboxamide |
| SMILES | O=C(NC1CC1)N1Cc2cc(Cl)ccc2-n2c(nnc2N2CC3(CN(c4ccc(F)cn4)C3)C2)C1 |
| InChI | InChI=1S/C24H24ClFN8O/c25-16-1-5-19-15(7-16)9-31(23(35)28-18-3-4-18)10-21-29-30-22(34(19)21)33-13-24(14-33)11-32(12-24)20-6-2-17(26)8-27-20/h1-2,5-8,18H,3-4,9-14H2,(H,28,35) |
| InChIKey | YBANALSZSMCRNE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 82.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.96 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |