C24H22N8O3 — CID 154936589
2-hydroxy-N-[4-[3-methyl-4-[(E)-1-(methylideneamino)-2-(4-methyl-1,2,4-triazol-3-yl)ethenoxy]anilino]quinazolin-6-yl]prop-2-enamide (PubChem CID 154936589) has the molecular formula C24H22N8O3 and a molecular weight of 470.49 g/mol. Its IUPAC name is 2-hydroxy-N-[4-[3-methyl-4-[(E)-1-(methylideneamino)-2-(4-methyl-1,2,4-triazol-3-yl)ethenoxy]anilino]quinazolin-6-yl]prop-2-enamide.
| Compound Name | 2-hydroxy-N-[4-[3-methyl-4-[(E)-1-(methylideneamino)-2-(4-methyl-1,2,4-triazol-3-yl)ethenoxy]anilino]quinazolin-6-yl]prop-2-enamide |
|---|---|
| PubChem CID | 154936589 |
| Molecular Formula | C24H22N8O3 |
| Molecular Weight | 470.49 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | 2-hydroxy-N-[4-[3-methyl-4-[(E)-1-(methylideneamino)-2-(4-methyl-1,2,4-triazol-3-yl)ethenoxy]anilino]quinazolin-6-yl]prop-2-enamide |
| SMILES | C=N/C(=C\c1nncn1C)Oc1ccc(Nc2ncnc3ccc(NC(=O)C(=C)O)cc23)cc1C |
| InChI | InChI=1S/C24H22N8O3/c1-14-9-16(6-8-20(14)35-22(25-3)11-21-31-28-13-32(21)4)29-23-18-10-17(30-24(34)15(2)33)5-7-19(18)26-12-27-23/h5-13,33H,2-3H2,1,4H3,(H,30,34)(H,26,27,29)/b22-11+ |
| InChIKey | LXVQPTCCAISGGD-SSDVNMTOSA-N |
| XLogP | 3.90 |
| TPSA | 139.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.49 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|