C30H33N9O3 — CID 154936728
(E)-N-[7-ethoxy-4-[3-methyl-4-[(E)-1-(methylideneamino)-2-(4-methyl-1,2,4-triazol-3-yl)ethenoxy]anilino]quinazolin-6-yl]-3-[(2R)-pyrrolidin-2-yl]prop-2-enamide (PubChem CID 154936728) has the molecular formula C30H33N9O3 and a molecular weight of 567.65 g/mol. Its IUPAC name is (E)-N-[7-ethoxy-4-[3-methyl-4-[(E)-1-(methylideneamino)-2-(4-methyl-1,2,4-triazol-3-yl)ethenoxy]anilino]quinazolin-6-yl]-3-[(2R)-pyrrolidin-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[7-ethoxy-4-[3-methyl-4-[(E)-1-(methylideneamino)-2-(4-methyl-1,2,4-triazol-3-yl)ethenoxy]anilino]quinazolin-6-yl]-3-[(2R)-pyrrolidin-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 154936728 |
| Molecular Formula | C30H33N9O3 |
| Molecular Weight | 567.65 g/mol |
| Exact Mass | 567.27 |
| IUPAC Name | (E)-N-[7-ethoxy-4-[3-methyl-4-[(E)-1-(methylideneamino)-2-(4-methyl-1,2,4-triazol-3-yl)ethenoxy]anilino]quinazolin-6-yl]-3-[(2R)-pyrrolidin-2-yl]prop-2-enamide |
| SMILES | C=N/C(=C\c1nncn1C)Oc1ccc(Nc2ncnc3cc(OCC)c(NC(=O)/C=C/[C@H]4CCCN4)cc23)cc1C |
| InChI | InChI=1S/C30H33N9O3/c1-5-41-26-15-23-22(14-24(26)37-28(40)11-9-20-7-6-12-32-20)30(34-17-33-23)36-21-8-10-25(19(2)13-21)42-29(31-3)16-27-38-35-18-39(27)4/h8-11,13-18,20,32H,3,5-7,12H2,1-2,4H3,(H,37,40)(H,33,34,36)/b11-9+,29-16+/t20-/m1/s1 |
| InChIKey | YMVCFJLNEBSXPA-BBVTVMAESA-N |
| XLogP | 4.53 |
| TPSA | 140.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.65 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|