C29H31N9O2 — CID 154936690
N-[(3S)-1-[4-[3-methyl-4-[(E)-1-(methylideneamino)-2-(4-methyl-1,2,4-triazol-3-yl)ethenoxy]anilino]quinazolin-6-yl]piperidin-3-yl]prop-2-enamide (PubChem CID 154936690) has the molecular formula C29H31N9O2 and a molecular weight of 537.63 g/mol. Its IUPAC name is N-[(3S)-1-[4-[3-methyl-4-[(E)-1-(methylideneamino)-2-(4-methyl-1,2,4-triazol-3-yl)ethenoxy]anilino]quinazolin-6-yl]piperidin-3-yl]prop-2-enamide.
| Compound Name | N-[(3S)-1-[4-[3-methyl-4-[(E)-1-(methylideneamino)-2-(4-methyl-1,2,4-triazol-3-yl)ethenoxy]anilino]quinazolin-6-yl]piperidin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 154936690 |
| Molecular Formula | C29H31N9O2 |
| Molecular Weight | 537.63 g/mol |
| Exact Mass | 537.26 |
| IUPAC Name | N-[(3S)-1-[4-[3-methyl-4-[(E)-1-(methylideneamino)-2-(4-methyl-1,2,4-triazol-3-yl)ethenoxy]anilino]quinazolin-6-yl]piperidin-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@H]1CCCN(c2ccc3ncnc(Nc4ccc(O/C(=C/c5nncn5C)N=C)c(C)c4)c3c2)C1 |
| InChI | InChI=1S/C29H31N9O2/c1-5-27(39)34-21-7-6-12-38(16-21)22-9-10-24-23(14-22)29(32-17-31-24)35-20-8-11-25(19(2)13-20)40-28(30-3)15-26-36-33-18-37(26)4/h5,8-11,13-15,17-18,21H,1,3,6-7,12,16H2,2,4H3,(H,34,39)(H,31,32,35)/b28-15+/t21-/m0/s1 |
| InChIKey | XHLDSOIOVUACDS-MMOHFDRGSA-N |
| XLogP | 4.16 |
| TPSA | 122.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.63 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|