C48H32N4O — CID 154936597
(2E)-3-(methylideneamino)-2-[12-oxo-2,9-bis(N-phenylanilino)indeno[1,2-c]fluoren-7-ylidene]propanenitrile (PubChem CID 154936597) has the molecular formula C48H32N4O and a molecular weight of 680.81 g/mol. Its IUPAC name is (2E)-3-(methylideneamino)-2-[12-oxo-2,9-bis(N-phenylanilino)indeno[1,2-c]fluoren-7-ylidene]propanenitrile.
| Compound Name | (2E)-3-(methylideneamino)-2-[12-oxo-2,9-bis(N-phenylanilino)indeno[1,2-c]fluoren-7-ylidene]propanenitrile |
|---|---|
| PubChem CID | 154936597 |
| Molecular Formula | C48H32N4O |
| Molecular Weight | 680.81 g/mol |
| Exact Mass | 680.26 |
| IUPAC Name | (2E)-3-(methylideneamino)-2-[12-oxo-2,9-bis(N-phenylanilino)indeno[1,2-c]fluoren-7-ylidene]propanenitrile |
| SMILES | C=NC/C(C#N)=C1/c2cc(N(c3ccccc3)c3ccccc3)ccc2-c2c1ccc1c2C(=O)c2cc(N(c3ccccc3)c3ccccc3)ccc2-1 |
| InChI | InChI=1S/C48H32N4O/c1-50-31-32(30-49)45-42-27-26-40-39-24-22-38(52(35-18-10-4-11-19-35)36-20-12-5-13-21-36)29-44(39)48(53)47(40)46(42)41-25-23-37(28-43(41)45)51(33-14-6-2-7-15-33)34-16-8-3-9-17-34/h2-29H,1,31H2/b45-32+ |
| InChIKey | BAIQVZGRAPNMNT-ZHPLTJAJSA-N |
| XLogP | 11.84 |
| TPSA | 59.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.81 |
| LogP ≤ 5 | 11.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|