C22H20ClN5O — CID 154938344
N-(4-chloro-3-pyridin-2-ylphenyl)-4-[[(methylideneamino)-(methyliminomethyl)amino]methyl]benzamide (PubChem CID 154938344) has the molecular formula C22H20ClN5O and a molecular weight of 405.89 g/mol. Its IUPAC name is N-(4-chloro-3-pyridin-2-ylphenyl)-4-[[(methylideneamino)-(methyliminomethyl)amino]methyl]benzamide.
| Compound Name | N-(4-chloro-3-pyridin-2-ylphenyl)-4-[[(methylideneamino)-(methyliminomethyl)amino]methyl]benzamide |
|---|---|
| PubChem CID | 154938344 |
| Molecular Formula | C22H20ClN5O |
| Molecular Weight | 405.89 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | N-(4-chloro-3-pyridin-2-ylphenyl)-4-[[(methylideneamino)-(methyliminomethyl)amino]methyl]benzamide |
| SMILES | C=NN(/C=N/C)Cc1ccc(C(=O)Nc2ccc(Cl)c(-c3ccccn3)c2)cc1 |
| InChI | InChI=1S/C22H20ClN5O/c1-24-15-28(25-2)14-16-6-8-17(9-7-16)22(29)27-18-10-11-20(23)19(13-18)21-5-3-4-12-26-21/h3-13,15H,2,14H2,1H3,(H,27,29)/b24-15+ |
| InChIKey | ORYSERJHBDCENF-BUVRLJJBSA-N |
| XLogP | 4.73 |
| TPSA | 69.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.89 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|