C24H22ClN3O — CID 143198916
N-(4-chloro-3-pyridin-2-ylphenyl)-4-[[[(1Z,3E)-penta-1,3-dienyl]amino]methyl]benzamide (PubChem CID 143198916) has the molecular formula C24H22ClN3O and a molecular weight of 403.91 g/mol. Its IUPAC name is N-(4-chloro-3-pyridin-2-ylphenyl)-4-[[[(1Z,3E)-penta-1,3-dienyl]amino]methyl]benzamide.
| Compound Name | N-(4-chloro-3-pyridin-2-ylphenyl)-4-[[[(1Z,3E)-penta-1,3-dienyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 143198916 |
| Molecular Formula | C24H22ClN3O |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | N-(4-chloro-3-pyridin-2-ylphenyl)-4-[[[(1Z,3E)-penta-1,3-dienyl]amino]methyl]benzamide |
| SMILES | C/C=C/C=C\NCc1ccc(C(=O)Nc2ccc(Cl)c(-c3ccccn3)c2)cc1 |
| InChI | InChI=1S/C24H22ClN3O/c1-2-3-5-14-26-17-18-8-10-19(11-9-18)24(29)28-20-12-13-22(25)21(16-20)23-7-4-6-15-27-23/h2-16,26H,17H2,1H3,(H,28,29)/b3-2+,14-5- |
| InChIKey | DVBZHRIRANNVAE-CVBFYWNISA-N |
| XLogP | 5.83 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|