C20H21N7O — CID 154938985
1-ethyl-N-(5-morpholin-4-yl-2-pyridinyl)pyrazolo[4,5-h]quinazolin-8-amine (PubChem CID 154938985) has the molecular formula C20H21N7O and a molecular weight of 375.44 g/mol. Its IUPAC name is 1-ethyl-N-(5-morpholin-4-yl-2-pyridinyl)pyrazolo[4,5-h]quinazolin-8-amine.
| Compound Name | 1-ethyl-N-(5-morpholin-4-yl-2-pyridinyl)pyrazolo[4,5-h]quinazolin-8-amine |
|---|---|
| PubChem CID | 154938985 |
| Molecular Formula | C20H21N7O |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 1-ethyl-N-(5-morpholin-4-yl-2-pyridinyl)pyrazolo[4,5-h]quinazolin-8-amine |
| SMILES | CCn1ncc2ccc3cnc(Nc4ccc(N5CCOCC5)cn4)nc3c21 |
| InChI | InChI=1S/C20H21N7O/c1-2-27-19-15(12-23-27)4-3-14-11-22-20(25-18(14)19)24-17-6-5-16(13-21-17)26-7-9-28-10-8-26/h3-6,11-13H,2,7-10H2,1H3,(H,21,22,24,25) |
| InChIKey | UQQPOWOCTBANCZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 80.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |