C21H28N8O — CID 167046550
8-[amino(2-methylpropyl)amino]-2-N-(5-morpholin-4-yl-2-pyridinyl)quinazoline-2,7-diamine (PubChem CID 167046550) has the molecular formula C21H28N8O and a molecular weight of 408.51 g/mol. Its IUPAC name is 8-[amino(2-methylpropyl)amino]-2-N-(5-morpholin-4-yl-2-pyridinyl)quinazoline-2,7-diamine.
| Compound Name | 8-[amino(2-methylpropyl)amino]-2-N-(5-morpholin-4-yl-2-pyridinyl)quinazoline-2,7-diamine |
|---|---|
| PubChem CID | 167046550 |
| Molecular Formula | C21H28N8O |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | 8-[amino(2-methylpropyl)amino]-2-N-(5-morpholin-4-yl-2-pyridinyl)quinazoline-2,7-diamine |
| SMILES | CC(C)CN(N)c1c(N)ccc2cnc(Nc3ccc(N4CCOCC4)cn3)nc12 |
| InChI | InChI=1S/C21H28N8O/c1-14(2)13-29(23)20-17(22)5-3-15-11-25-21(27-19(15)20)26-18-6-4-16(12-24-18)28-7-9-30-10-8-28/h3-6,11-12,14H,7-10,13,22-23H2,1-2H3,(H,24,25,26,27) |
| InChIKey | PQDPJOSDNLSHOO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|