C21H22N6O — CID 167655081
9-ethyl-N-(5-morpholin-4-yl-2-pyridinyl)pyrrolo[3,2-h]quinazolin-2-amine (PubChem CID 167655081) has the molecular formula C21H22N6O and a molecular weight of 374.45 g/mol. Its IUPAC name is 9-ethyl-N-(5-morpholin-4-yl-2-pyridinyl)pyrrolo[3,2-h]quinazolin-2-amine.
| Compound Name | 9-ethyl-N-(5-morpholin-4-yl-2-pyridinyl)pyrrolo[3,2-h]quinazolin-2-amine |
|---|---|
| PubChem CID | 167655081 |
| Molecular Formula | C21H22N6O |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 9-ethyl-N-(5-morpholin-4-yl-2-pyridinyl)pyrrolo[3,2-h]quinazolin-2-amine |
| SMILES | CCn1ccc2ccc3cnc(Nc4ccc(N5CCOCC5)cn4)nc3c21 |
| InChI | InChI=1S/C21H22N6O/c1-2-26-8-7-15-3-4-16-13-23-21(25-19(16)20(15)26)24-18-6-5-17(14-22-18)27-9-11-28-12-10-27/h3-8,13-14H,2,9-12H2,1H3,(H,22,23,24,25) |
| InChIKey | OAEGWJSBNWIBMW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |