C5H13IN2 — CID 154940046
1-N'-iodo-1-N,1-N,1-N'-trimethylethane-1,1-diamine (PubChem CID 154940046) has the molecular formula C5H13IN2 and a molecular weight of 228.08 g/mol. Its IUPAC name is 1-N'-iodo-1-N,1-N,1-N'-trimethylethane-1,1-diamine.
| Compound Name | 1-N'-iodo-1-N,1-N,1-N'-trimethylethane-1,1-diamine |
|---|---|
| PubChem CID | 154940046 |
| Molecular Formula | C5H13IN2 |
| Molecular Weight | 228.08 g/mol |
| Exact Mass | 228.01 |
| IUPAC Name | 1-N'-iodo-1-N,1-N,1-N'-trimethylethane-1,1-diamine |
| SMILES | CC(N(C)C)N(C)I |
| InChI | InChI=1S/C5H13IN2/c1-5(7(2)3)8(4)6/h5H,1-4H3 |
| InChIKey | IHHIXXXINNPYAX-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.08 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|