About 1-[1-hydroxyethyl(methyl)amino]ethanol;hydrate
1-[1-hydroxyethyl(methyl)amino]ethanol;hydrate (PubChem CID 173435253) has the molecular formula C5H15NO3
and a molecular weight of 137.18 g/mol. Its IUPAC name is 1-[1-hydroxyethyl(methyl)amino]ethanol;hydrate.
Molecular Properties
| Compound Name | 1-[1-hydroxyethyl(methyl)amino]ethanol;hydrate |
| PubChem CID | 173435253 |
| Molecular Formula | C5H15NO3 |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.11 |
| IUPAC Name | 1-[1-hydroxyethyl(methyl)amino]ethanol;hydrate |
| SMILES | CC(O)N(C)C(C)O.O |
| InChI | InChI=1S/C5H13NO2.H2O/c1-4(7)6(3)5(2)8;/h4-5,7-8H,1-3H3;1H2 |
| InChIKey | PDNHRCOHTYNYLT-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-[1-hydroxyethyl(methyl)amino]ethanol;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-hydroxyethyl(methyl)amino]ethanol;hydrate?
The IUPAC name of 1-[1-hydroxyethyl(methyl)amino]ethanol;hydrate (CID 173435253) is 1-[1-hydroxyethyl(methyl)amino]ethanol;hydrate.
What is the SMILES notation for 1-[1-hydroxyethyl(methyl)amino]ethanol;hydrate?
The canonical SMILES for 1-[1-hydroxyethyl(methyl)amino]ethanol;hydrate is CC(O)N(C)C(C)O.O.
What is the InChIKey of 1-[1-hydroxyethyl(methyl)amino]ethanol;hydrate?
The InChIKey is PDNHRCOHTYNYLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13NO2.H2O/c1-4(7)6(3)5(2)8;/h4-5,7-8H,1-3H3;1H2.
What are the key properties of 1-[1-hydroxyethyl(methyl)amino]ethanol;hydrate?
1-[1-hydroxyethyl(methyl)amino]ethanol;hydrate has a molecular weight of 137.18 g/mol, XLogP of -1.23, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-hydroxyethyl(methyl)amino]ethanol;hydrate is sourced from PubChem (CID 173435253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).