About 1-[bis(1-hydroxyethyl)amino]ethanol;iron
1-[bis(1-hydroxyethyl)amino]ethanol;iron (PubChem CID 87467389) has the molecular formula C6H15FeNO3
and a molecular weight of 205.03 g/mol. Its IUPAC name is 1-[bis(1-hydroxyethyl)amino]ethanol;iron.
Molecular Properties
| Compound Name | 1-[bis(1-hydroxyethyl)amino]ethanol;iron |
| PubChem CID | 87467389 |
| Molecular Formula | C6H15FeNO3 |
| Molecular Weight | 205.03 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | 1-[bis(1-hydroxyethyl)amino]ethanol;iron |
| SMILES | CC(O)N(C(C)O)C(C)O.[Fe] |
| InChI | InChI=1S/C6H15NO3.Fe/c1-4(8)7(5(2)9)6(3)10;/h4-6,8-10H,1-3H3; |
| InChIKey | TWFZINCEEKEJOF-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.03 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-[bis(1-hydroxyethyl)amino]ethanol;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[bis(1-hydroxyethyl)amino]ethanol;iron?
The IUPAC name of 1-[bis(1-hydroxyethyl)amino]ethanol;iron (CID 87467389) is 1-[bis(1-hydroxyethyl)amino]ethanol;iron.
What is the SMILES notation for 1-[bis(1-hydroxyethyl)amino]ethanol;iron?
The canonical SMILES for 1-[bis(1-hydroxyethyl)amino]ethanol;iron is CC(O)N(C(C)O)C(C)O.[Fe].
What is the InChIKey of 1-[bis(1-hydroxyethyl)amino]ethanol;iron?
The InChIKey is TWFZINCEEKEJOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO3.Fe/c1-4(8)7(5(2)9)6(3)10;/h4-6,8-10H,1-3H3;.
What are the key properties of 1-[bis(1-hydroxyethyl)amino]ethanol;iron?
1-[bis(1-hydroxyethyl)amino]ethanol;iron has a molecular weight of 205.03 g/mol, XLogP of -0.70, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[bis(1-hydroxyethyl)amino]ethanol;iron is sourced from PubChem (CID 87467389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).