About 1-[2,2-bis(1-hydroxyethyl)hydrazinyl]ethanol
1-[2,2-bis(1-hydroxyethyl)hydrazinyl]ethanol (PubChem CID 57006246) has the molecular formula C6H16N2O3
and a molecular weight of 164.20 g/mol. Its IUPAC name is 1-[2,2-bis(1-hydroxyethyl)hydrazinyl]ethanol.
Molecular Properties
| Compound Name | 1-[2,2-bis(1-hydroxyethyl)hydrazinyl]ethanol |
| PubChem CID | 57006246 |
| Molecular Formula | C6H16N2O3 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | 1-[2,2-bis(1-hydroxyethyl)hydrazinyl]ethanol |
| SMILES | CC(O)NN(C(C)O)C(C)O |
| InChI | InChI=1S/C6H16N2O3/c1-4(9)7-8(5(2)10)6(3)11/h4-7,9-11H,1-3H3 |
| InChIKey | JTLNNESKKDACEI-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[2,2-bis(1-hydroxyethyl)hydrazinyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2,2-bis(1-hydroxyethyl)hydrazinyl]ethanol?
The IUPAC name of 1-[2,2-bis(1-hydroxyethyl)hydrazinyl]ethanol (CID 57006246) is 1-[2,2-bis(1-hydroxyethyl)hydrazinyl]ethanol.
What is the SMILES notation for 1-[2,2-bis(1-hydroxyethyl)hydrazinyl]ethanol?
The canonical SMILES for 1-[2,2-bis(1-hydroxyethyl)hydrazinyl]ethanol is CC(O)NN(C(C)O)C(C)O.
What is the InChIKey of 1-[2,2-bis(1-hydroxyethyl)hydrazinyl]ethanol?
The InChIKey is JTLNNESKKDACEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16N2O3/c1-4(9)7-8(5(2)10)6(3)11/h4-7,9-11H,1-3H3.
What are the key properties of 1-[2,2-bis(1-hydroxyethyl)hydrazinyl]ethanol?
1-[2,2-bis(1-hydroxyethyl)hydrazinyl]ethanol has a molecular weight of 164.20 g/mol, XLogP of -1.19, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2,2-bis(1-hydroxyethyl)hydrazinyl]ethanol is sourced from PubChem (CID 57006246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).