C25H20N4O5S — CID 154941053
[2-[2-(5-amino-6-methoxycarbonyl-3-pyridinyl)ethynyl]phenyl]-(7-methylquinolin-8-yl)sulfamic acid (PubChem CID 154941053) has the molecular formula C25H20N4O5S and a molecular weight of 488.53 g/mol. Its IUPAC name is [2-[2-(5-amino-6-methoxycarbonyl-3-pyridinyl)ethynyl]phenyl]-(7-methylquinolin-8-yl)sulfamic acid.
| Compound Name | [2-[2-(5-amino-6-methoxycarbonyl-3-pyridinyl)ethynyl]phenyl]-(7-methylquinolin-8-yl)sulfamic acid |
|---|---|
| PubChem CID | 154941053 |
| Molecular Formula | C25H20N4O5S |
| Molecular Weight | 488.53 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | [2-[2-(5-amino-6-methoxycarbonyl-3-pyridinyl)ethynyl]phenyl]-(7-methylquinolin-8-yl)sulfamic acid |
| SMILES | COC(=O)c1ncc(C#Cc2ccccc2N(c2c(C)ccc3cccnc23)S(=O)(=O)O)cc1N |
| InChI | InChI=1S/C25H20N4O5S/c1-16-9-11-19-7-5-13-27-22(19)24(16)29(35(31,32)33)21-8-4-3-6-18(21)12-10-17-14-20(26)23(28-15-17)25(30)34-2/h3-9,11,13-15H,26H2,1-2H3,(H,31,32,33) |
| InChIKey | IACXZNGOBWMTCV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 135.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.53 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|