C9H9BrN4O2S2 — CID 154941608
5-[(3-bromophenyl)methylamino]-1,3,4-thiadiazole-2-sulfonamide (PubChem CID 154941608) has the molecular formula C9H9BrN4O2S2 and a molecular weight of 349.24 g/mol. Its IUPAC name is 5-[(3-bromophenyl)methylamino]-1,3,4-thiadiazole-2-sulfonamide.
| Compound Name | 5-[(3-bromophenyl)methylamino]-1,3,4-thiadiazole-2-sulfonamide |
|---|---|
| PubChem CID | 154941608 |
| Molecular Formula | C9H9BrN4O2S2 |
| Molecular Weight | 349.24 g/mol |
| Exact Mass | 347.94 |
| IUPAC Name | 5-[(3-bromophenyl)methylamino]-1,3,4-thiadiazole-2-sulfonamide |
| SMILES | NS(=O)(=O)c1nnc(NCc2cccc(Br)c2)s1 |
| InChI | InChI=1S/C9H9BrN4O2S2/c10-7-3-1-2-6(4-7)5-12-8-13-14-9(17-8)18(11,15)16/h1-4H,5H2,(H,12,13)(H2,11,15,16) |
| InChIKey | KYSQKRXBACWCGY-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.24 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |