C10H8BrClN2O2S2 — CID 61401742
N-[(3-bromophenyl)methyl]-2-chloro-1,3-thiazole-5-sulfonamide (PubChem CID 61401742) has the molecular formula C10H8BrClN2O2S2 and a molecular weight of 367.68 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-2-chloro-1,3-thiazole-5-sulfonamide.
| Compound Name | N-[(3-bromophenyl)methyl]-2-chloro-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 61401742 |
| Molecular Formula | C10H8BrClN2O2S2 |
| Molecular Weight | 367.68 g/mol |
| Exact Mass | 365.89 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-2-chloro-1,3-thiazole-5-sulfonamide |
| SMILES | O=S(=O)(NCc1cccc(Br)c1)c1cnc(Cl)s1 |
| InChI | InChI=1S/C10H8BrClN2O2S2/c11-8-3-1-2-7(4-8)5-14-18(15,16)9-6-13-10(12)17-9/h1-4,6,14H,5H2 |
| InChIKey | GWWBTRFZGPTCRS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.68 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |