C12H12ClN3O3S2 — CID 61053150
N-benzyl-2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]acetamide (PubChem CID 61053150) has the molecular formula C12H12ClN3O3S2 and a molecular weight of 345.83 g/mol. Its IUPAC name is N-benzyl-2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]acetamide.
| Compound Name | N-benzyl-2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 61053150 |
| Molecular Formula | C12H12ClN3O3S2 |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | N-benzyl-2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]acetamide |
| SMILES | O=C(CNS(=O)(=O)c1cnc(Cl)s1)NCc1ccccc1 |
| InChI | InChI=1S/C12H12ClN3O3S2/c13-12-15-8-11(20-12)21(18,19)16-7-10(17)14-6-9-4-2-1-3-5-9/h1-5,8,16H,6-7H2,(H,14,17) |
| InChIKey | JKGSCLAESPQQPR-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |