About N-benzyl-2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]acetamide
N-benzyl-2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]acetamide (PubChem CID 61053150) has the molecular formula C12H12ClN3O3S2
and a molecular weight of 345.83 g/mol. Its IUPAC name is N-benzyl-2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]acetamide.
Molecular Properties
| Compound Name | N-benzyl-2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]acetamide |
| PubChem CID | 61053150 |
| Molecular Formula | C12H12ClN3O3S2 |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | N-benzyl-2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]acetamide |
| SMILES | O=C(CNS(=O)(=O)c1cnc(Cl)s1)NCc1ccccc1 |
| InChI | InChI=1S/C12H12ClN3O3S2/c13-12-15-8-11(20-12)21(18,19)16-7-10(17)14-6-9-4-2-1-3-5-9/h1-5,8,16H,6-7H2,(H,14,17) |
| InChIKey | JKGSCLAESPQQPR-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-benzyl-2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]acetamide?
The IUPAC name of N-benzyl-2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]acetamide (CID 61053150) is N-benzyl-2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]acetamide.
What is the SMILES notation for N-benzyl-2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]acetamide?
The canonical SMILES for N-benzyl-2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]acetamide is O=C(CNS(=O)(=O)c1cnc(Cl)s1)NCc1ccccc1.
What is the InChIKey of N-benzyl-2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]acetamide?
The InChIKey is JKGSCLAESPQQPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12ClN3O3S2/c13-12-15-8-11(20-12)21(18,19)16-7-10(17)14-6-9-4-2-1-3-5-9/h1-5,8,16H,6-7H2,(H,14,17).
What are the key properties of N-benzyl-2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]acetamide?
N-benzyl-2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]acetamide has a molecular weight of 345.83 g/mol, XLogP of 1.39, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]acetamide is sourced from PubChem (CID 61053150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).