C11H10ClFN2O2S2 — CID 43566269
2-chloro-N-[2-(3-fluorophenyl)ethyl]-1,3-thiazole-5-sulfonamide (PubChem CID 43566269) has the molecular formula C11H10ClFN2O2S2 and a molecular weight of 320.80 g/mol. Its IUPAC name is 2-chloro-N-[2-(3-fluorophenyl)ethyl]-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-chloro-N-[2-(3-fluorophenyl)ethyl]-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 43566269 |
| Molecular Formula | C11H10ClFN2O2S2 |
| Molecular Weight | 320.80 g/mol |
| Exact Mass | 319.99 |
| IUPAC Name | 2-chloro-N-[2-(3-fluorophenyl)ethyl]-1,3-thiazole-5-sulfonamide |
| SMILES | O=S(=O)(NCCc1cccc(F)c1)c1cnc(Cl)s1 |
| InChI | InChI=1S/C11H10ClFN2O2S2/c12-11-14-7-10(18-11)19(16,17)15-5-4-8-2-1-3-9(13)6-8/h1-3,6-7,15H,4-5H2 |
| InChIKey | QIFITCDLOVOKBO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.80 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |