C11H20O3S — CID 154945274
3-[(2-methylpropan-2-yl)oxy]-7-sulfanylhept-4-enoic acid (PubChem CID 154945274) has the molecular formula C11H20O3S and a molecular weight of 232.34 g/mol. Its IUPAC name is 3-[(2-methylpropan-2-yl)oxy]-7-sulfanylhept-4-enoic acid.
| Compound Name | 3-[(2-methylpropan-2-yl)oxy]-7-sulfanylhept-4-enoic acid |
|---|---|
| PubChem CID | 154945274 |
| Molecular Formula | C11H20O3S |
| Molecular Weight | 232.34 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 3-[(2-methylpropan-2-yl)oxy]-7-sulfanylhept-4-enoic acid |
| SMILES | CC(C)(C)OC(C=CCCS)CC(=O)O |
| InChI | InChI=1S/C11H20O3S/c1-11(2,3)14-9(8-10(12)13)6-4-5-7-15/h4,6,9,15H,5,7-8H2,1-3H3,(H,12,13) |
| InChIKey | DXFWIVGKCMHIOR-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|