C17H15N7OS — CID 154945782
bis(formonitrile);N-(6-methanehydrazonoyl-1,3-benzothiazol-2-yl)-5-methylpyridine-3-carboxamide (PubChem CID 154945782) has the molecular formula C17H15N7OS and a molecular weight of 365.42 g/mol. Its IUPAC name is bis(formonitrile);N-(6-methanehydrazonoyl-1,3-benzothiazol-2-yl)-5-methylpyridine-3-carboxamide.
| Compound Name | bis(formonitrile);N-(6-methanehydrazonoyl-1,3-benzothiazol-2-yl)-5-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 154945782 |
| Molecular Formula | C17H15N7OS |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | bis(formonitrile);N-(6-methanehydrazonoyl-1,3-benzothiazol-2-yl)-5-methylpyridine-3-carboxamide |
| SMILES | C#N.C#N.Cc1cncc(C(=O)Nc2nc3ccc(C=NN)cc3s2)c1 |
| InChI | InChI=1S/C15H13N5OS.2CHN/c1-9-4-11(8-17-6-9)14(21)20-15-19-12-3-2-10(7-18-16)5-13(12)22-15;2*1-2/h2-8H,16H2,1H3,(H,19,20,21);2*1H |
| InChIKey | WOCIHUOGZIXHHU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 140.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|