C13H21F3N2 — CID 154946033
1-methyl-4-[(2S)-1-(3,3,3-trifluoropropyl)pyrrolidin-2-yl]-3,6-dihydro-2H-pyridine (PubChem CID 154946033) has the molecular formula C13H21F3N2 and a molecular weight of 262.32 g/mol. Its IUPAC name is 1-methyl-4-[(2S)-1-(3,3,3-trifluoropropyl)pyrrolidin-2-yl]-3,6-dihydro-2H-pyridine.
| Compound Name | 1-methyl-4-[(2S)-1-(3,3,3-trifluoropropyl)pyrrolidin-2-yl]-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 154946033 |
| Molecular Formula | C13H21F3N2 |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 1-methyl-4-[(2S)-1-(3,3,3-trifluoropropyl)pyrrolidin-2-yl]-3,6-dihydro-2H-pyridine |
| SMILES | CN1CC=C([C@@H]2CCCN2CCC(F)(F)F)CC1 |
| InChI | InChI=1S/C13H21F3N2/c1-17-8-4-11(5-9-17)12-3-2-7-18(12)10-6-13(14,15)16/h4,12H,2-3,5-10H2,1H3/t12-/m0/s1 |
| InChIKey | PZMHDNQRHNWHIV-LBPRGKRZSA-N |
| XLogP | 2.67 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|