C27H25Cl2NO6 — CID 154946335
[(3S,3aR,6S,6aR)-6-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-6a-methyl-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan-3-yl] benzoate (PubChem CID 154946335) has the molecular formula C27H25Cl2NO6 and a molecular weight of 530.40 g/mol. Its IUPAC name is [(3S,3aR,6S,6aR)-6-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-6a-methyl-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan-3-yl] benzoate.
| Compound Name | [(3S,3aR,6S,6aR)-6-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-6a-methyl-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan-3-yl] benzoate |
|---|---|
| PubChem CID | 154946335 |
| Molecular Formula | C27H25Cl2NO6 |
| Molecular Weight | 530.40 g/mol |
| Exact Mass | 529.11 |
| IUPAC Name | [(3S,3aR,6S,6aR)-6-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-6a-methyl-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan-3-yl] benzoate |
| SMILES | C[C@]12OC[C@H](OC(=O)c3ccccc3)[C@H]1OC[C@@H]2OCc1c(-c2c(Cl)cccc2Cl)noc1C1CC1 |
| InChI | InChI=1S/C27H25Cl2NO6/c1-27-21(14-33-25(27)20(13-34-27)35-26(31)16-6-3-2-4-7-16)32-12-17-23(30-36-24(17)15-10-11-15)22-18(28)8-5-9-19(22)29/h2-9,15,20-21,25H,10-14H2,1H3/t20-,21-,25+,27+/m0/s1 |
| InChIKey | CYRPGVXCUGZUDP-UMLWDEEUSA-N |
| XLogP | 5.82 |
| TPSA | 80.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.40 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |