C46H28N4O — CID 154950032
3-[3-(6-dibenzofuran-3-yl-2-phenylpyrimidin-4-yl)-5-quinolin-3-ylphenyl]quinoline (PubChem CID 154950032) has the molecular formula C46H28N4O and a molecular weight of 652.76 g/mol. Its IUPAC name is 3-[3-(6-dibenzofuran-3-yl-2-phenylpyrimidin-4-yl)-5-quinolin-3-ylphenyl]quinoline.
| Compound Name | 3-[3-(6-dibenzofuran-3-yl-2-phenylpyrimidin-4-yl)-5-quinolin-3-ylphenyl]quinoline |
|---|---|
| PubChem CID | 154950032 |
| Molecular Formula | C46H28N4O |
| Molecular Weight | 652.76 g/mol |
| Exact Mass | 652.23 |
| IUPAC Name | 3-[3-(6-dibenzofuran-3-yl-2-phenylpyrimidin-4-yl)-5-quinolin-3-ylphenyl]quinoline |
| SMILES | c1ccc(-c2nc(-c3cc(-c4cnc5ccccc5c4)cc(-c4cnc5ccccc5c4)c3)cc(-c3ccc4c(c3)oc3ccccc34)n2)cc1 |
| InChI | InChI=1S/C46H28N4O/c1-2-10-29(11-3-1)46-49-42(32-18-19-39-38-14-6-9-17-44(38)51-45(39)25-32)26-43(50-46)35-23-33(36-20-30-12-4-7-15-40(30)47-27-36)22-34(24-35)37-21-31-13-5-8-16-41(31)48-28-37/h1-28H |
| InChIKey | AYWJMRFFRVLKDU-UHFFFAOYSA-N |
| XLogP | 11.81 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.76 |
| LogP ≤ 5 | 11.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |