C23H30N2O4 — CID 154951679
benzyl 2-(5-cyclononyloxy-4-methyl-6-oxopyrimidin-1-yl)acetate (PubChem CID 154951679) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is benzyl 2-(5-cyclononyloxy-4-methyl-6-oxopyrimidin-1-yl)acetate.
| Compound Name | benzyl 2-(5-cyclononyloxy-4-methyl-6-oxopyrimidin-1-yl)acetate |
|---|---|
| PubChem CID | 154951679 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | benzyl 2-(5-cyclononyloxy-4-methyl-6-oxopyrimidin-1-yl)acetate |
| SMILES | Cc1ncn(CC(=O)OCc2ccccc2)c(=O)c1OC1CCCCCCCC1 |
| InChI | InChI=1S/C23H30N2O4/c1-18-22(29-20-13-9-4-2-3-5-10-14-20)23(27)25(17-24-18)15-21(26)28-16-19-11-7-6-8-12-19/h6-8,11-12,17,20H,2-5,9-10,13-16H2,1H3 |
| InChIKey | OKPUJBPGMBJDPS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |