C36H61FN2O6 — CID 154956753
1-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dipropyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-5-fluoro-3-(3,7,11,15-tetramethylhexadec-2-enyl)pyrimidine-2,4-dione (PubChem CID 154956753) has the molecular formula C36H61FN2O6 and a molecular weight of 636.89 g/mol. Its IUPAC name is 1-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dipropyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-5-fluoro-3-(3,7,11,15-tetramethylhexadec-2-enyl)pyrimidine-2,4-dione.
| Compound Name | 1-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dipropyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-5-fluoro-3-(3,7,11,15-tetramethylhexadec-2-enyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 154956753 |
| Molecular Formula | C36H61FN2O6 |
| Molecular Weight | 636.89 g/mol |
| Exact Mass | 636.45 |
| IUPAC Name | 1-[(3aR,4R,6R,6aR)-6-(hydroxymethyl)-2,2-dipropyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-5-fluoro-3-(3,7,11,15-tetramethylhexadec-2-enyl)pyrimidine-2,4-dione |
| SMILES | CCCC1(CCC)O[C@@H]2[C@H](O1)[C@@H](CO)O[C@H]2n1cc(F)c(=O)n(CC=C(C)CCCC(C)CCCC(C)CCCC(C)C)c1=O |
| InChI | InChI=1S/C36H61FN2O6/c1-8-20-36(21-9-2)44-31-30(24-40)43-34(32(31)45-36)39-23-29(37)33(41)38(35(39)42)22-19-28(7)18-12-17-27(6)16-11-15-26(5)14-10-13-25(3)4/h19,23,25-27,30-32,34,40H,8-18,20-22,24H2,1-7H3/t26?,27?,30-,31-,32-,34-/m1/s1 |
| InChIKey | NMHDTHXLIBIYJU-QHPMKVRVSA-N |
| XLogP | 7.50 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.89 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|