C19H17N5O5 — CID 15495793
5-hydroxy-3-(4-methoxy-3-nitrophenyl)-4,8-dimethyl-7-oxo-6-azabicyclo[3.2.1]octane-1,2,2-tricarbonitrile (PubChem CID 15495793) has the molecular formula C19H17N5O5 and a molecular weight of 395.38 g/mol. Its IUPAC name is 5-hydroxy-3-(4-methoxy-3-nitrophenyl)-4,8-dimethyl-7-oxo-6-azabicyclo[3.2.1]octane-1,2,2-tricarbonitrile.
| Compound Name | 5-hydroxy-3-(4-methoxy-3-nitrophenyl)-4,8-dimethyl-7-oxo-6-azabicyclo[3.2.1]octane-1,2,2-tricarbonitrile |
|---|---|
| PubChem CID | 15495793 |
| Molecular Formula | C19H17N5O5 |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 5-hydroxy-3-(4-methoxy-3-nitrophenyl)-4,8-dimethyl-7-oxo-6-azabicyclo[3.2.1]octane-1,2,2-tricarbonitrile |
| SMILES | COc1ccc(C2C(C)C3(O)NC(=O)C(C#N)(C3C)C2(C#N)C#N)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H17N5O5/c1-10-15(12-4-5-14(29-3)13(6-12)24(27)28)17(7-20,8-21)18(9-22)11(2)19(10,26)23-16(18)25/h4-6,10-11,15,26H,1-3H3,(H,23,25) |
| InChIKey | RSSUBFSMVOKNNE-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 173.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|