C11H13Cl3O3 — CID 15495829
3-hydroxy-2-(1,1,1-trichloro-4-oxopentan-3-yl)cyclohex-2-en-1-one (PubChem CID 15495829) has the molecular formula C11H13Cl3O3 and a molecular weight of 299.58 g/mol. Its IUPAC name is 3-hydroxy-2-(1,1,1-trichloro-4-oxopentan-3-yl)cyclohex-2-en-1-one.
| Compound Name | 3-hydroxy-2-(1,1,1-trichloro-4-oxopentan-3-yl)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 15495829 |
| Molecular Formula | C11H13Cl3O3 |
| Molecular Weight | 299.58 g/mol |
| Exact Mass | 297.99 |
| IUPAC Name | 3-hydroxy-2-(1,1,1-trichloro-4-oxopentan-3-yl)cyclohex-2-en-1-one |
| SMILES | CC(=O)C(CC(Cl)(Cl)Cl)C1=C(O)CCCC1=O |
| InChI | InChI=1S/C11H13Cl3O3/c1-6(15)7(5-11(12,13)14)10-8(16)3-2-4-9(10)17/h7,16H,2-5H2,1H3 |
| InChIKey | FASFVFVWLCEODN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.58 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|