C18H21NO5 — CID 154963124
(1S,5R,6S)-6,7-dihydroxy-13-methoxy-4,16-dimethyl-11-oxa-4-azapentacyclo[8.7.0.01,6.03,5.012,17]heptadeca-12,14,16-trien-9-one (PubChem CID 154963124) has the molecular formula C18H21NO5 and a molecular weight of 331.37 g/mol. Its IUPAC name is (1S,5R,6S)-6,7-dihydroxy-13-methoxy-4,16-dimethyl-11-oxa-4-azapentacyclo[8.7.0.01,6.03,5.012,17]heptadeca-12,14,16-trien-9-one.
| Compound Name | (1S,5R,6S)-6,7-dihydroxy-13-methoxy-4,16-dimethyl-11-oxa-4-azapentacyclo[8.7.0.01,6.03,5.012,17]heptadeca-12,14,16-trien-9-one |
|---|---|
| PubChem CID | 154963124 |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | (1S,5R,6S)-6,7-dihydroxy-13-methoxy-4,16-dimethyl-11-oxa-4-azapentacyclo[8.7.0.01,6.03,5.012,17]heptadeca-12,14,16-trien-9-one |
| SMILES | COc1ccc(C)c2c1OC1C(=O)CC(O)[C@@]3(O)[C@H]4C(C[C@]213)N4C |
| InChI | InChI=1S/C18H21NO5/c1-8-4-5-11(23-3)14-13(8)17-7-9-15(19(9)2)18(17,22)12(21)6-10(20)16(17)24-14/h4-5,9,12,15-16,21-22H,6-7H2,1-3H3/t9?,12?,15-,16?,17+,18-,19?/m1/s1 |
| InChIKey | ZGKFMZPGOMISHJ-WILWTKHXSA-N |
| XLogP | 0.15 |
| TPSA | 79.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|