C19H23NO5 — CID 118148880
(4aS,5R,7aR,12bS)-4a,5-dihydroxy-9-methoxy-1,3-dimethyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one (PubChem CID 118148880) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is (4aS,5R,7aR,12bS)-4a,5-dihydroxy-9-methoxy-1,3-dimethyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one.
| Compound Name | (4aS,5R,7aR,12bS)-4a,5-dihydroxy-9-methoxy-1,3-dimethyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
|---|---|
| PubChem CID | 118148880 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | (4aS,5R,7aR,12bS)-4a,5-dihydroxy-9-methoxy-1,3-dimethyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
| SMILES | COc1ccc2c3c1O[C@H]1C(=O)C[C@@H](O)[C@@]4(O)C(C2)N(C)CC(C)[C@]314 |
| InChI | InChI=1S/C19H23NO5/c1-9-8-20(2)13-6-10-4-5-12(24-3)16-15(10)18(9)17(25-16)11(21)7-14(22)19(13,18)23/h4-5,9,13-14,17,22-23H,6-8H2,1-3H3/t9?,13?,14-,17+,18+,19+/m1/s1 |
| InChIKey | QQBHSLOMTGVJCP-GAIPXPDNSA-N |
| XLogP | 0.26 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |