C17H26FN2O5P — CID 154966994
N-[1-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]propan-2-yl]-4-fluoro-5-methoxy-2-phosphanylbenzamide (PubChem CID 154966994) has the molecular formula C17H26FN2O5P and a molecular weight of 388.38 g/mol. Its IUPAC name is N-[1-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]propan-2-yl]-4-fluoro-5-methoxy-2-phosphanylbenzamide.
| Compound Name | N-[1-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]propan-2-yl]-4-fluoro-5-methoxy-2-phosphanylbenzamide |
|---|---|
| PubChem CID | 154966994 |
| Molecular Formula | C17H26FN2O5P |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | N-[1-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]propan-2-yl]-4-fluoro-5-methoxy-2-phosphanylbenzamide |
| SMILES | COc1cc(C(=O)NC(C)CNC(=O)C(O)C(C)(C)CO)c(P)cc1F |
| InChI | InChI=1S/C17H26FN2O5P/c1-9(7-19-16(24)14(22)17(2,3)8-21)20-15(23)10-5-12(25-4)11(18)6-13(10)26/h5-6,9,14,21-22H,7-8,26H2,1-4H3,(H,19,24)(H,20,23) |
| InChIKey | AJHMEJRGXYIOJB-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|