C6H12N2OS — CID 154967162
N'-ethenyl-N,N-dimethyl-1-methylsulfinylmethanimidamide (PubChem CID 154967162) has the molecular formula C6H12N2OS and a molecular weight of 160.24 g/mol. Its IUPAC name is N'-ethenyl-N,N-dimethyl-1-methylsulfinylmethanimidamide.
| Compound Name | N'-ethenyl-N,N-dimethyl-1-methylsulfinylmethanimidamide |
|---|---|
| PubChem CID | 154967162 |
| Molecular Formula | C6H12N2OS |
| Molecular Weight | 160.24 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | N'-ethenyl-N,N-dimethyl-1-methylsulfinylmethanimidamide |
| SMILES | C=C/N=C(\N(C)C)S(C)=O |
| InChI | InChI=1S/C6H12N2OS/c1-5-7-6(8(2)3)10(4)9/h5H,1H2,2-4H3/b7-6+ |
| InChIKey | HTNGDNZEGJSXRQ-VOTSOKGWSA-N |
| XLogP | 0.43 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.24 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|