C27H36N6O — CID 154969323
1-[[4-[[3-(cyclohexylamino)propylamino]methyl]phenyl]methyl]-3-(pyridin-2-ylmethylamino)pyrazin-2-one (PubChem CID 154969323) has the molecular formula C27H36N6O and a molecular weight of 460.63 g/mol. Its IUPAC name is 1-[[4-[[3-(cyclohexylamino)propylamino]methyl]phenyl]methyl]-3-(pyridin-2-ylmethylamino)pyrazin-2-one.
| Compound Name | 1-[[4-[[3-(cyclohexylamino)propylamino]methyl]phenyl]methyl]-3-(pyridin-2-ylmethylamino)pyrazin-2-one |
|---|---|
| PubChem CID | 154969323 |
| Molecular Formula | C27H36N6O |
| Molecular Weight | 460.63 g/mol |
| Exact Mass | 460.30 |
| IUPAC Name | 1-[[4-[[3-(cyclohexylamino)propylamino]methyl]phenyl]methyl]-3-(pyridin-2-ylmethylamino)pyrazin-2-one |
| SMILES | O=c1c(NCc2ccccn2)nccn1Cc1ccc(CNCCCNC2CCCCC2)cc1 |
| InChI | InChI=1S/C27H36N6O/c34-27-26(32-20-25-9-4-5-15-30-25)31-17-18-33(27)21-23-12-10-22(11-13-23)19-28-14-6-16-29-24-7-2-1-3-8-24/h4-5,9-13,15,17-18,24,28-29H,1-3,6-8,14,16,19-21H2,(H,31,32) |
| InChIKey | NBFQKOZHWLLKAL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 83.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.63 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|