C28H41N5O — CID 154969314
(3S)-1-[[4-[[3-(cyclohexylamino)propylamino]methyl]phenyl]methyl]-3-methyl-4-(pyridin-2-ylmethyl)piperazin-2-one (PubChem CID 154969314) has the molecular formula C28H41N5O and a molecular weight of 463.67 g/mol. Its IUPAC name is (3S)-1-[[4-[[3-(cyclohexylamino)propylamino]methyl]phenyl]methyl]-3-methyl-4-(pyridin-2-ylmethyl)piperazin-2-one.
| Compound Name | (3S)-1-[[4-[[3-(cyclohexylamino)propylamino]methyl]phenyl]methyl]-3-methyl-4-(pyridin-2-ylmethyl)piperazin-2-one |
|---|---|
| PubChem CID | 154969314 |
| Molecular Formula | C28H41N5O |
| Molecular Weight | 463.67 g/mol |
| Exact Mass | 463.33 |
| IUPAC Name | (3S)-1-[[4-[[3-(cyclohexylamino)propylamino]methyl]phenyl]methyl]-3-methyl-4-(pyridin-2-ylmethyl)piperazin-2-one |
| SMILES | C[C@H]1C(=O)N(Cc2ccc(CNCCCNC3CCCCC3)cc2)CCN1Cc1ccccn1 |
| InChI | InChI=1S/C28H41N5O/c1-23-28(34)33(19-18-32(23)22-27-10-5-6-16-31-27)21-25-13-11-24(12-14-25)20-29-15-7-17-30-26-8-3-2-4-9-26/h5-6,10-14,16,23,26,29-30H,2-4,7-9,15,17-22H2,1H3/t23-/m0/s1 |
| InChIKey | KUZPQJUFZRRIJL-QHCPKHFHSA-N |
| XLogP | 3.72 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.67 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|