C26H36N4O3 — CID 154974790
(4-methoxycyclohexyl)-[8-(6-methyl-1,4-oxazepan-4-yl)-4,4a,5,11-tetrahydropyrido[3,2-c][1,5]benzodiazepin-6-yl]methanone (PubChem CID 154974790) has the molecular formula C26H36N4O3 and a molecular weight of 452.60 g/mol. Its IUPAC name is (4-methoxycyclohexyl)-[8-(6-methyl-1,4-oxazepan-4-yl)-4,4a,5,11-tetrahydropyrido[3,2-c][1,5]benzodiazepin-6-yl]methanone.
| Compound Name | (4-methoxycyclohexyl)-[8-(6-methyl-1,4-oxazepan-4-yl)-4,4a,5,11-tetrahydropyrido[3,2-c][1,5]benzodiazepin-6-yl]methanone |
|---|---|
| PubChem CID | 154974790 |
| Molecular Formula | C26H36N4O3 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | (4-methoxycyclohexyl)-[8-(6-methyl-1,4-oxazepan-4-yl)-4,4a,5,11-tetrahydropyrido[3,2-c][1,5]benzodiazepin-6-yl]methanone |
| SMILES | COC1CCC(C(=O)N2CC3CC=CN=C3Nc3ccc(N4CCOCC(C)C4)cc32)CC1 |
| InChI | InChI=1S/C26H36N4O3/c1-18-15-29(12-13-33-17-18)21-7-10-23-24(14-21)30(16-20-4-3-11-27-25(20)28-23)26(31)19-5-8-22(32-2)9-6-19/h3,7,10-11,14,18-20,22H,4-6,8-9,12-13,15-17H2,1-2H3,(H,27,28) |
| InChIKey | BKRPJFMOLIVLJU-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |